- Joined
- Sep 22, 2008
- Messages
- 602
- Reaction score
- 2
- Points
- 0
I've been trying to prove that sin(a+b)=sin(a)cos(b)+sin(b)cos(a), and I've come across the following triangle:
View attachment 4352
The problem is that the cosine law an the pythagorean theorem disagree as to the value of H.
Using the smaller triangle and the pythagorean theorem:
H^2 = [1 - sen(a)]^2 + cos^2(a)
H^2 = 1 - 2sen(a) + sen^2(a) + cos^2(a)
H^2 = 2 - 2sen(a)
H = sqr(2[1 - sen(a)])
Using the bigger triangle and the cosine law:
H^2 = 1^2 + 1^2 - 2*1*1*cos(a)
H^2 = 2 - 2cos(a)
H = sqr(2[1 - cos(a)])
If this is right, then cos(a) = sen(a), which is not true for most values of a. What am I doing wrong here?
View attachment 4352
The problem is that the cosine law an the pythagorean theorem disagree as to the value of H.
Using the smaller triangle and the pythagorean theorem:
H^2 = [1 - sen(a)]^2 + cos^2(a)
H^2 = 1 - 2sen(a) + sen^2(a) + cos^2(a)
H^2 = 2 - 2sen(a)
H = sqr(2[1 - sen(a)])
Using the bigger triangle and the cosine law:
H^2 = 1^2 + 1^2 - 2*1*1*cos(a)
H^2 = 2 - 2cos(a)
H = sqr(2[1 - cos(a)])
If this is right, then cos(a) = sen(a), which is not true for most values of a. What am I doing wrong here?
Last edited: